C16H22Cl2N2O — CID 43791661
4-[1-(3,4-dichlorophenyl)propylamino]cyclohexane-1-carboxamide (PubChem CID 43791661) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)propylamino]cyclohexane-1-carboxamide.
| Compound Name | 4-[1-(3,4-dichlorophenyl)propylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 43791661 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)propylamino]cyclohexane-1-carboxamide |
| SMILES | CCC(NC1CCC(C(N)=O)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-2-15(11-5-8-13(17)14(18)9-11)20-12-6-3-10(4-7-12)16(19)21/h5,8-10,12,15,20H,2-4,6-7H2,1H3,(H2,19,21) |
| InChIKey | GKDHMNCBGSXANH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |