C15H17Cl2NOS — CID 107361780
N-[2-(3-chlorophenoxy)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 107361780) has the molecular formula C15H17Cl2NOS and a molecular weight of 330.28 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-chlorophenoxy)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107361780 |
| Molecular Formula | C15H17Cl2NOS |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[2-(3-chlorophenoxy)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(COc1cccc(Cl)c1)c1sccc1Cl |
| InChI | InChI=1S/C15H17Cl2NOS/c1-2-7-18-14(15-13(17)6-8-20-15)10-19-12-5-3-4-11(16)9-12/h3-6,8-9,14,18H,2,7,10H2,1H3 |
| InChIKey | WWUKEIBZEFXMQC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |