C12H14ClNS2 — CID 80529345
N-[(3-chlorothiophen-2-yl)-thiophen-3-ylmethyl]propan-1-amine (PubChem CID 80529345) has the molecular formula C12H14ClNS2 and a molecular weight of 271.84 g/mol. Its IUPAC name is N-[(3-chlorothiophen-2-yl)-thiophen-3-ylmethyl]propan-1-amine.
| Compound Name | N-[(3-chlorothiophen-2-yl)-thiophen-3-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 80529345 |
| Molecular Formula | C12H14ClNS2 |
| Molecular Weight | 271.84 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | N-[(3-chlorothiophen-2-yl)-thiophen-3-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccsc1)c1sccc1Cl |
| InChI | InChI=1S/C12H14ClNS2/c1-2-5-14-11(9-3-6-15-8-9)12-10(13)4-7-16-12/h3-4,6-8,11,14H,2,5H2,1H3 |
| InChIKey | KEEXGVCUKNDCKZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |