C15H20BrN3OS — CID 105151019
N-[2-(2-bromo-5-methoxyphenyl)-1-(4-methylthiadiazol-5-yl)ethyl]propan-1-amine (PubChem CID 105151019) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is N-[2-(2-bromo-5-methoxyphenyl)-1-(4-methylthiadiazol-5-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-bromo-5-methoxyphenyl)-1-(4-methylthiadiazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105151019 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[2-(2-bromo-5-methoxyphenyl)-1-(4-methylthiadiazol-5-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(OC)ccc1Br)c1snnc1C |
| InChI | InChI=1S/C15H20BrN3OS/c1-4-7-17-14(15-10(2)18-19-21-15)9-11-8-12(20-3)5-6-13(11)16/h5-6,8,14,17H,4,7,9H2,1-3H3 |
| InChIKey | LQIXFSFWLFIHFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |