C12H14BrN3OS — CID 105150939
2-(2-bromo-5-methoxyphenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine (PubChem CID 105150939) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine.
| Compound Name | 2-(2-bromo-5-methoxyphenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105150939 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
| SMILES | CNC(Cc1cc(OC)ccc1Br)c1csnn1 |
| InChI | InChI=1S/C12H14BrN3OS/c1-14-11(12-7-18-16-15-12)6-8-5-9(17-2)3-4-10(8)13/h3-5,7,11,14H,6H2,1-2H3 |
| InChIKey | CWDXZFZSEYYYMY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |