C9H10BrN3S2 — CID 105139402
2-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine (PubChem CID 105139402) has the molecular formula C9H10BrN3S2 and a molecular weight of 304.24 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105139402 |
| Molecular Formula | C9H10BrN3S2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
| SMILES | CNC(Cc1sccc1Br)c1csnn1 |
| InChI | InChI=1S/C9H10BrN3S2/c1-11-7(8-5-15-13-12-8)4-9-6(10)2-3-14-9/h2-3,5,7,11H,4H2,1H3 |
| InChIKey | HFQXUUNYWKLRQQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |