C9H11N3OS — CID 105177550
2-(furan-3-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine (PubChem CID 105177550) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(furan-3-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine.
| Compound Name | 2-(furan-3-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105177550 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(furan-3-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
| SMILES | CNC(Cc1ccoc1)c1csnn1 |
| InChI | InChI=1S/C9H11N3OS/c1-10-8(9-6-14-12-11-9)4-7-2-3-13-5-7/h2-3,5-6,8,10H,4H2,1H3 |
| InChIKey | BNUUNTPFWCGFQC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |