C11H11Cl2N3S — CID 105132366
2-(2,4-dichlorophenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine (PubChem CID 105132366) has the molecular formula C11H11Cl2N3S and a molecular weight of 288.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105132366 |
| Molecular Formula | C11H11Cl2N3S |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
| SMILES | CNC(Cc1ccc(Cl)cc1Cl)c1csnn1 |
| InChI | InChI=1S/C11H11Cl2N3S/c1-14-10(11-6-17-16-15-11)4-7-2-3-8(12)5-9(7)13/h2-3,5-6,10,14H,4H2,1H3 |
| InChIKey | MITGGJIGWKYCKY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |