C13H14Cl2N4S2 — CID 166237256
1-[2-(2,4-dichlorophenyl)ethyl]-3-[1-(thiadiazol-4-yl)ethyl]thiourea (PubChem CID 166237256) has the molecular formula C13H14Cl2N4S2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)ethyl]-3-[1-(thiadiazol-4-yl)ethyl]thiourea.
| Compound Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-[1-(thiadiazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 166237256 |
| Molecular Formula | C13H14Cl2N4S2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-[1-(thiadiazol-4-yl)ethyl]thiourea |
| SMILES | CC(NC(=S)NCCc1ccc(Cl)cc1Cl)c1csnn1 |
| InChI | InChI=1S/C13H14Cl2N4S2/c1-8(12-7-21-19-18-12)17-13(20)16-5-4-9-2-3-10(14)6-11(9)15/h2-3,6-8H,4-5H2,1H3,(H2,16,17,20) |
| InChIKey | XNEJGVLYBMWUDJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|