C11H15N3S2 — CID 105135916
2-(5-ethylthiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine (PubChem CID 105135916) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine.
| Compound Name | 2-(5-ethylthiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105135916 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)-N-methyl-1-(thiadiazol-4-yl)ethanamine |
| SMILES | CCc1ccc(CC(NC)c2csnn2)s1 |
| InChI | InChI=1S/C11H15N3S2/c1-3-8-4-5-9(16-8)6-10(12-2)11-7-15-14-13-11/h4-5,7,10,12H,3,6H2,1-2H3 |
| InChIKey | YFJKTZVZMYMAQY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |