C11H16BrF2N3 — CID 106945415
3-(3-bromo-2,6-difluorophenyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine (PubChem CID 106945415) has the molecular formula C11H16BrF2N3 and a molecular weight of 308.17 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-bromo-2,6-difluorophenyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 106945415 |
| Molecular Formula | C11H16BrF2N3 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC(NN)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H16BrF2N3/c1-17(2)6-5-9(16-15)10-8(13)4-3-7(12)11(10)14/h3-4,9,16H,5-6,15H2,1-2H3 |
| InChIKey | CNYRWAAWPKJWQA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|