C11H11BrF5N — CID 106942324
1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3,3,3-trifluoropropan-1-amine (PubChem CID 106942324) has the molecular formula C11H11BrF5N and a molecular weight of 332.11 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3,3,3-trifluoropropan-1-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 106942324 |
| Molecular Formula | C11H11BrF5N |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-3,3,3-trifluoropropan-1-amine |
| SMILES | CCNC(CC(F)(F)F)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H11BrF5N/c1-2-18-8(5-11(15,16)17)9-7(13)4-3-6(12)10(9)14/h3-4,8,18H,2,5H2,1H3 |
| InChIKey | QUVVPAPYAGXCEB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|