C12H19BrClNO2 — CID 171268073
2-[(1S,2R)-1-amino-2-hydroxyhexyl]-5-bromophenol;hydrochloride (PubChem CID 171268073) has the molecular formula C12H19BrClNO2 and a molecular weight of 324.65 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-5-bromophenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-5-bromophenol;hydrochloride |
|---|---|
| PubChem CID | 171268073 |
| Molecular Formula | C12H19BrClNO2 |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-5-bromophenol;hydrochloride |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1ccc(Br)cc1O.Cl |
| InChI | InChI=1S/C12H18BrNO2.ClH/c1-2-3-4-10(15)12(14)9-6-5-8(13)7-11(9)16;/h5-7,10,12,15-16H,2-4,14H2,1H3;1H/t10-,12+;/m1./s1 |
| InChIKey | GCQBRVYNXARGAT-IYJPBCIQSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|