C12H19BrClNO — CID 171204721
2-[(1R)-1-amino-4-methylpentyl]-5-bromophenol;hydrochloride (PubChem CID 171204721) has the molecular formula C12H19BrClNO and a molecular weight of 308.65 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4-methylpentyl]-5-bromophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-4-methylpentyl]-5-bromophenol;hydrochloride |
|---|---|
| PubChem CID | 171204721 |
| Molecular Formula | C12H19BrClNO |
| Molecular Weight | 308.65 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[(1R)-1-amino-4-methylpentyl]-5-bromophenol;hydrochloride |
| SMILES | CC(C)CC[C@@H](N)c1ccc(Br)cc1O.Cl |
| InChI | InChI=1S/C12H18BrNO.ClH/c1-8(2)3-6-11(14)10-5-4-9(13)7-12(10)15;/h4-5,7-8,11,15H,3,6,14H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | ZLHVSKQULOQDKT-RFVHGSKJSA-N |
| XLogP | 4.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|