C8H8ClNO4 — CID 170823452
3-(3-chloro-2-pyridinyl)-2,3-dihydroxypropanoic acid (PubChem CID 170823452) has the molecular formula C8H8ClNO4 and a molecular weight of 217.61 g/mol. Its IUPAC name is 3-(3-chloro-2-pyridinyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(3-chloro-2-pyridinyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823452 |
| Molecular Formula | C8H8ClNO4 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-(3-chloro-2-pyridinyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1ncccc1Cl |
| InChI | InChI=1S/C8H8ClNO4/c9-4-2-1-3-10-5(4)6(11)7(12)8(13)14/h1-3,6-7,11-12H,(H,13,14) |
| InChIKey | PNCZRGZHBTZOFD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |