C11H16BrNO3 — CID 171882378
4-amino-1-(4-bromo-2-methoxyphenyl)butane-1,2-diol (PubChem CID 171882378) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 4-amino-1-(4-bromo-2-methoxyphenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(4-bromo-2-methoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171882378 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 4-amino-1-(4-bromo-2-methoxyphenyl)butane-1,2-diol |
| SMILES | COc1cc(Br)ccc1C(O)C(O)CCN |
| InChI | InChI=1S/C11H16BrNO3/c1-16-10-6-7(12)2-3-8(10)11(15)9(14)4-5-13/h2-3,6,9,11,14-15H,4-5,13H2,1H3 |
| InChIKey | XYXGJMHIKCSVQT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |