C12H16BrNO4 — CID 171892688
ethyl 6-(4-bromo-1,2-dihydroxybutyl)pyridine-2-carboxylate (PubChem CID 171892688) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is ethyl 6-(4-bromo-1,2-dihydroxybutyl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-(4-bromo-1,2-dihydroxybutyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171892688 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | ethyl 6-(4-bromo-1,2-dihydroxybutyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(C(O)C(O)CCBr)n1 |
| InChI | InChI=1S/C12H16BrNO4/c1-2-18-12(17)9-5-3-4-8(14-9)11(16)10(15)6-7-13/h3-5,10-11,15-16H,2,6-7H2,1H3 |
| InChIKey | ZWLXHJXJPZDRLE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|