C10H13BrClNO4S — CID 171892695
4-(4-bromo-1,2-dihydroxybutyl)-2-chlorobenzenesulfonamide (PubChem CID 171892695) has the molecular formula C10H13BrClNO4S and a molecular weight of 358.64 g/mol. Its IUPAC name is 4-(4-bromo-1,2-dihydroxybutyl)-2-chlorobenzenesulfonamide.
| Compound Name | 4-(4-bromo-1,2-dihydroxybutyl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 171892695 |
| Molecular Formula | C10H13BrClNO4S |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 4-(4-bromo-1,2-dihydroxybutyl)-2-chlorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(O)C(O)CCBr)cc1Cl |
| InChI | InChI=1S/C10H13BrClNO4S/c11-4-3-8(14)10(15)6-1-2-9(7(12)5-6)18(13,16)17/h1-2,5,8,10,14-15H,3-4H2,(H2,13,16,17) |
| InChIKey | GAGABDGTRLAUAA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|