C13H18ClNO3S — CID 171875024
3-chloro-N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propanamide (PubChem CID 171875024) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propanamide.
| Compound Name | 3-chloro-N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propanamide |
|---|---|
| PubChem CID | 171875024 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-chloro-N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propanamide |
| SMILES | O=C(CCCl)Nc1ccc(C(O)C(O)CCS)cc1 |
| InChI | InChI=1S/C13H18ClNO3S/c14-7-5-12(17)15-10-3-1-9(2-4-10)13(18)11(16)6-8-19/h1-4,11,13,16,18-19H,5-8H2,(H,15,17) |
| InChIKey | LGFBWCICCQAKMK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|