C11H14N2O — CID 131124936
N-[4-[(1S)-1-aminoprop-2-enyl]phenyl]acetamide (PubChem CID 131124936) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-[4-[(1S)-1-aminoprop-2-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(1S)-1-aminoprop-2-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 131124936 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-[4-[(1S)-1-aminoprop-2-enyl]phenyl]acetamide |
| SMILES | C=C[C@H](N)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C11H14N2O/c1-3-11(12)9-4-6-10(7-5-9)13-8(2)14/h3-7,11H,1,12H2,2H3,(H,13,14)/t11-/m0/s1 |
| InChIKey | QJWGEJFZHRVNMC-NSHDSACASA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|