C11H14ClN3O — CID 171259999
N-[4-[(1S)-1-amino-2-cyanoethyl]phenyl]acetamide;hydrochloride (PubChem CID 171259999) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is N-[4-[(1S)-1-amino-2-cyanoethyl]phenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[(1S)-1-amino-2-cyanoethyl]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 171259999 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-[4-[(1S)-1-amino-2-cyanoethyl]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc([C@@H](N)CC#N)cc1.Cl |
| InChI | InChI=1S/C11H13N3O.ClH/c1-8(15)14-10-4-2-9(3-5-10)11(13)6-7-12;/h2-5,11H,6,13H2,1H3,(H,14,15);1H/t11-;/m0./s1 |
| InChIKey | IZTACNVAIZGHPQ-MERQFXBCSA-N |
| XLogP | 1.98 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |