C7H9N5O4 — CID 170825708
5-(3-azido-1,2-dihydroxypropyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 170825708) has the molecular formula C7H9N5O4 and a molecular weight of 227.18 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170825708 |
| Molecular Formula | C7H9N5O4 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C7H9N5O4/c8-12-11-1-3(13)5(14)4-6(15)9-2-10-7(4)16/h2-3,5,13-14H,1H2,(H2,9,10,15,16) |
| InChIKey | MABDUYCBBPUJNO-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 155.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|