C9H11N7O3 — CID 171879662
3-(4-azido-1,2-dihydroxybutyl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 171879662) has the molecular formula C9H11N7O3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 3-(4-azido-1,2-dihydroxybutyl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3-(4-azido-1,2-dihydroxybutyl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171879662 |
| Molecular Formula | C9H11N7O3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-(4-azido-1,2-dihydroxybutyl)-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1[nH]nc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C9H11N7O3/c10-16-13-2-1-4(17)7(18)6-5-8(15-14-6)11-3-12-9(5)19/h3-4,7,17-18H,1-2H2,(H2,11,12,14,15,19) |
| InChIKey | FXRUFSCCBDLNKP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|