C15H13Cl3O2 — CID 125466536
(2S)-2-(4-chlorophenyl)-3-(2,4-dichlorophenoxy)propan-1-ol (PubChem CID 125466536) has the molecular formula C15H13Cl3O2 and a molecular weight of 331.63 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-3-(2,4-dichlorophenoxy)propan-1-ol.
| Compound Name | (2S)-2-(4-chlorophenyl)-3-(2,4-dichlorophenoxy)propan-1-ol |
|---|---|
| PubChem CID | 125466536 |
| Molecular Formula | C15H13Cl3O2 |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-3-(2,4-dichlorophenoxy)propan-1-ol |
| SMILES | OC[C@@H](COc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3O2/c16-12-3-1-10(2-4-12)11(8-19)9-20-15-6-5-13(17)7-14(15)18/h1-7,11,19H,8-9H2/t11-/m0/s1 |
| InChIKey | ZPRNXHYWYJSSLH-NSHDSACASA-N |
| XLogP | 4.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |