C11H14ClF2NO3 — CID 168594806
3-[5-chloro-2-(2,2-difluoroethoxy)anilino]propane-1,2-diol (PubChem CID 168594806) has the molecular formula C11H14ClF2NO3 and a molecular weight of 281.69 g/mol. Its IUPAC name is 3-[5-chloro-2-(2,2-difluoroethoxy)anilino]propane-1,2-diol.
| Compound Name | 3-[5-chloro-2-(2,2-difluoroethoxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594806 |
| Molecular Formula | C11H14ClF2NO3 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-[5-chloro-2-(2,2-difluoroethoxy)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cc(Cl)ccc1OCC(F)F |
| InChI | InChI=1S/C11H14ClF2NO3/c12-7-1-2-10(18-6-11(13)14)9(3-7)15-4-8(17)5-16/h1-3,8,11,15-17H,4-6H2 |
| InChIKey | ZVZHADIJJSHAHU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |