C9H9ClF2N2O — CID 82004072
5-chloro-2-(2,2-difluoroethoxy)benzenecarboximidamide (PubChem CID 82004072) has the molecular formula C9H9ClF2N2O and a molecular weight of 234.63 g/mol. Its IUPAC name is 5-chloro-2-(2,2-difluoroethoxy)benzenecarboximidamide.
| Compound Name | 5-chloro-2-(2,2-difluoroethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 82004072 |
| Molecular Formula | C9H9ClF2N2O |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 5-chloro-2-(2,2-difluoroethoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Cl)ccc1OCC(F)F |
| InChI | InChI=1S/C9H9ClF2N2O/c10-5-1-2-7(15-4-8(11)12)6(3-5)9(13)14/h1-3,8H,4H2,(H3,13,14) |
| InChIKey | MVJKKYTXYFLARH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|