C15H9Cl2NO3 — CID 155153991
2-cyano-5-[(2,4-dichlorophenoxy)methyl]benzoic acid (PubChem CID 155153991) has the molecular formula C15H9Cl2NO3 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-cyano-5-[(2,4-dichlorophenoxy)methyl]benzoic acid.
| Compound Name | 2-cyano-5-[(2,4-dichlorophenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 155153991 |
| Molecular Formula | C15H9Cl2NO3 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 2-cyano-5-[(2,4-dichlorophenoxy)methyl]benzoic acid |
| SMILES | N#Cc1ccc(COc2ccc(Cl)cc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C15H9Cl2NO3/c16-11-3-4-14(13(17)6-11)21-8-9-1-2-10(7-18)12(5-9)15(19)20/h1-6H,8H2,(H,19,20) |
| InChIKey | CUZSWBQUQCAFSX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |