C15H24Cl2NO+ — CID 2247783
butyl-[5-(2,4-dichlorophenoxy)pentyl]azanium (PubChem CID 2247783) has the molecular formula C15H24Cl2NO+ and a molecular weight of 305.27 g/mol. Its IUPAC name is butyl-[5-(2,4-dichlorophenoxy)pentyl]azanium.
| Compound Name | butyl-[5-(2,4-dichlorophenoxy)pentyl]azanium |
|---|---|
| PubChem CID | 2247783 |
| Molecular Formula | C15H24Cl2NO+ |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | butyl-[5-(2,4-dichlorophenoxy)pentyl]azanium |
| SMILES | CCCC[NH2+]CCCCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H23Cl2NO/c1-2-3-9-18-10-5-4-6-11-19-15-8-7-13(16)12-14(15)17/h7-8,12,18H,2-6,9-11H2,1H3/p+1 |
| InChIKey | ABSGBWBKWSDDFT-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|