C14H22Cl2NO+ — CID 2261994
butyl-[4-(2,5-dichlorophenoxy)butyl]azanium (PubChem CID 2261994) has the molecular formula C14H22Cl2NO+ and a molecular weight of 291.24 g/mol. Its IUPAC name is butyl-[4-(2,5-dichlorophenoxy)butyl]azanium.
| Compound Name | butyl-[4-(2,5-dichlorophenoxy)butyl]azanium |
|---|---|
| PubChem CID | 2261994 |
| Molecular Formula | C14H22Cl2NO+ |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | butyl-[4-(2,5-dichlorophenoxy)butyl]azanium |
| SMILES | CCCC[NH2+]CCCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H21Cl2NO/c1-2-3-8-17-9-4-5-10-18-14-11-12(15)6-7-13(14)16/h6-7,11,17H,2-5,8-10H2,1H3/p+1 |
| InChIKey | QXEWFQJJPMLVNJ-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|