C14H15Cl2NO2 — CID 27241388
4-[4-(2,5-dichlorophenoxy)but-2-ynyl]morpholine (PubChem CID 27241388) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.18 g/mol. Its IUPAC name is 4-[4-(2,5-dichlorophenoxy)but-2-ynyl]morpholine.
| Compound Name | 4-[4-(2,5-dichlorophenoxy)but-2-ynyl]morpholine |
|---|---|
| PubChem CID | 27241388 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-[4-(2,5-dichlorophenoxy)but-2-ynyl]morpholine |
| SMILES | Clc1ccc(Cl)c(OCC#CCN2CCOCC2)c1 |
| InChI | InChI=1S/C14H15Cl2NO2/c15-12-3-4-13(16)14(11-12)19-8-2-1-5-17-6-9-18-10-7-17/h3-4,11H,5-10H2 |
| InChIKey | IAVOCFHPRMGVHZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|