C15H14Cl2N4O — CID 16728636
2-[(E)-[4-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]guanidine (PubChem CID 16728636) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-[(E)-[4-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[4-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 16728636 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[(E)-[4-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1ccc(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2N4O/c16-12-4-1-10(2-5-12)9-22-14-7-13(17)6-3-11(14)8-20-21-15(18)19/h1-8H,9H2,(H4,18,19,21)/b20-8+ |
| InChIKey | REIBIJZUPUGDDY-DNTJNYDQSA-N |
| XLogP | 3.18 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|