C19H14ClF2N3O4S — CID 168620384
2-[2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620384) has the molecular formula C19H14ClF2N3O4S and a molecular weight of 453.85 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620384 |
| Molecular Formula | C19H14ClF2N3O4S |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-[2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2cc(Cl)ccc2OCc2cc(F)ccc2F)NC1=O |
| InChI | InChI=1S/C19H14ClF2N3O4S/c20-12-1-4-15(29-9-11-6-13(21)2-3-14(11)22)10(5-12)8-23-25-19-24-18(28)16(30-19)7-17(26)27/h1-6,8,16H,7,9H2,(H,26,27)(H,24,25,28) |
| InChIKey | IPVOUJOJLLWUCO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|