C20H22N4O3S — CID 9031104
2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-1-(3,4-dimethoxyphenyl)propan-2-ylideneamino]acetamide (PubChem CID 9031104) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-1-(3,4-dimethoxyphenyl)propan-2-ylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-1-(3,4-dimethoxyphenyl)propan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 9031104 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-1-(3,4-dimethoxyphenyl)propan-2-ylideneamino]acetamide |
| SMILES | COc1ccc(C/C(C)=N\NC(=O)CNc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C20H22N4O3S/c1-13(10-14-8-9-16(26-2)17(11-14)27-3)23-24-19(25)12-21-20-22-15-6-4-5-7-18(15)28-20/h4-9,11H,10,12H2,1-3H3,(H,21,22)(H,24,25)/b23-13- |
| InChIKey | OIZZVUPSPZQIBU-QRVIBDJDSA-N |
| XLogP | 3.46 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|