C17H15IN2O3S — CID 74223661
2-(3,4-dimethoxyphenyl)-N-(6-iodo-1,3-benzothiazol-2-yl)acetamide (PubChem CID 74223661) has the molecular formula C17H15IN2O3S and a molecular weight of 454.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(6-iodo-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(6-iodo-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 74223661 |
| Molecular Formula | C17H15IN2O3S |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(6-iodo-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nc3ccc(I)cc3s2)cc1OC |
| InChI | InChI=1S/C17H15IN2O3S/c1-22-13-6-3-10(7-14(13)23-2)8-16(21)20-17-19-12-5-4-11(18)9-15(12)24-17/h3-7,9H,8H2,1-2H3,(H,19,20,21) |
| InChIKey | CBQLIQOITRGNBE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|