C18H17ClN4O4 — CID 4679765
N-(2-chlorophenyl)-N'-[(4-methyl-3-nitrophenyl)methylideneamino]butanediamide (PubChem CID 4679765) has the molecular formula C18H17ClN4O4 and a molecular weight of 388.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(4-methyl-3-nitrophenyl)methylideneamino]butanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(4-methyl-3-nitrophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 4679765 |
| Molecular Formula | C18H17ClN4O4 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(4-methyl-3-nitrophenyl)methylideneamino]butanediamide |
| SMILES | Cc1ccc(C=NNC(=O)CCC(=O)Nc2ccccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17ClN4O4/c1-12-6-7-13(10-16(12)23(26)27)11-20-22-18(25)9-8-17(24)21-15-5-3-2-4-14(15)19/h2-7,10-11H,8-9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | VUXBKLVWTLWFBV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|