C18H17ClN4O4 — CID 3282009
N-benzyl-N'-[(4-chloro-3-nitrophenyl)methylideneamino]butanediamide (PubChem CID 3282009) has the molecular formula C18H17ClN4O4 and a molecular weight of 388.81 g/mol. Its IUPAC name is N-benzyl-N'-[(4-chloro-3-nitrophenyl)methylideneamino]butanediamide.
| Compound Name | N-benzyl-N'-[(4-chloro-3-nitrophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3282009 |
| Molecular Formula | C18H17ClN4O4 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-benzyl-N'-[(4-chloro-3-nitrophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)NN=Cc1ccc(Cl)c([N+](=O)[O-])c1)NCc1ccccc1 |
| InChI | InChI=1S/C18H17ClN4O4/c19-15-7-6-14(10-16(15)23(26)27)12-21-22-18(25)9-8-17(24)20-11-13-4-2-1-3-5-13/h1-7,10,12H,8-9,11H2,(H,20,24)(H,22,25) |
| InChIKey | GYWZFIYXBFIZLT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|