C25H16FN7O5S4 — CID 99656410
N-(4-fluoro-3-nitrophenyl)-2-[[6-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 99656410) has the molecular formula C25H16FN7O5S4 and a molecular weight of 641.71 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-[[6-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-[[6-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 99656410 |
| Molecular Formula | C25H16FN7O5S4 |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.01 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-[[6-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1nnc(Sc2ccc(/C=N/c3ccc4nc(SCC(=O)Nc5ccc(F)c([N+](=O)[O-])c5)sc4c3)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C25H16FN7O5S4/c1-13-30-31-25(40-13)41-21-7-2-14(8-20(21)33(37)38)11-27-15-4-6-18-22(10-15)42-24(29-18)39-12-23(34)28-16-3-5-17(26)19(9-16)32(35)36/h2-11H,12H2,1H3,(H,28,34)/b27-11+ |
| InChIKey | XSNVZRVKWZRAMX-LUOAPIJWSA-N |
| XLogP | 7.04 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|