C28H18F3N5O3S3 — CID 99654785
2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 99654785) has the molecular formula C28H18F3N5O3S3 and a molecular weight of 625.68 g/mol. Its IUPAC name is 2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 99654785 |
| Molecular Formula | C28H18F3N5O3S3 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | 2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Sc4ccccn4)c([N+](=O)[O-])c3)cc2s1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H18F3N5O3S3/c29-28(30,31)18-4-3-5-20(13-18)34-25(37)16-40-27-35-21-9-8-19(14-24(21)42-27)33-15-17-7-10-23(22(12-17)36(38)39)41-26-6-1-2-11-32-26/h1-15H,16H2,(H,34,37)/b33-15+ |
| InChIKey | HUFXQNBXENLXOR-ROPCREHHSA-N |
| XLogP | 8.25 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|