C23H18BrN3O2S2 — CID 94848727
2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 94848727) has the molecular formula C23H18BrN3O2S2 and a molecular weight of 512.45 g/mol. Its IUPAC name is 2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 94848727 |
| Molecular Formula | C23H18BrN3O2S2 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | 2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3ccc(/N=C/c4ccc(Br)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C23H18BrN3O2S2/c1-29-19-9-6-17(7-10-19)26-22(28)14-30-23-27-20-11-8-18(12-21(20)31-23)25-13-15-2-4-16(24)5-3-15/h2-13H,14H2,1H3,(H,26,28)/b25-13+ |
| InChIKey | VQAJHJDUDNARSM-DHRITJCHSA-N |
| XLogP | 6.55 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|