C26H24BrN3OS2 — CID 5182795
2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2,6-diethylphenyl)acetamide (PubChem CID 5182795) has the molecular formula C26H24BrN3OS2 and a molecular weight of 538.54 g/mol. Its IUPAC name is 2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 5182795 |
| Molecular Formula | C26H24BrN3OS2 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 2-[[6-[(4-bromophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CSc1nc2ccc(/N=C/c3ccc(Br)cc3)cc2s1 |
| InChI | InChI=1S/C26H24BrN3OS2/c1-3-18-6-5-7-19(4-2)25(18)30-24(31)16-32-26-29-22-13-12-21(14-23(22)33-26)28-15-17-8-10-20(27)11-9-17/h5-15H,3-4,16H2,1-2H3,(H,30,31)/b28-15+ |
| InChIKey | HHEZNAVPDYORDE-RWPZCVJISA-N |
| XLogP | 7.66 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|