C22H16IN3O4S2 — CID 136890043
4-iodo-2-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol (PubChem CID 136890043) has the molecular formula C22H16IN3O4S2 and a molecular weight of 577.43 g/mol. Its IUPAC name is 4-iodo-2-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol.
| Compound Name | 4-iodo-2-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136890043 |
| Molecular Formula | C22H16IN3O4S2 |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 576.96 |
| IUPAC Name | 4-iodo-2-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1nc2ccc(/N=C/c3cc(I)ccc3O)cc2s1 |
| InChI | InChI=1S/C22H16IN3O4S2/c1-30-20-7-4-17(26(28)29)9-14(20)12-31-22-25-18-5-3-16(10-21(18)32-22)24-11-13-8-15(23)2-6-19(13)27/h2-11,27H,12H2,1H3/b24-11+ |
| InChIKey | ZDWJTFZMNNFDRP-BHGWPJFGSA-N |
| XLogP | 6.57 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|