About ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate
ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate (PubChem CID 144537002) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate |
| PubChem CID | 144537002 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate |
| SMILES | C=C.C=C.CC.CCc1c(O)ccc2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C14H14O3.C2H6.2C2H4/c1-3-11-12-6-4-10(14(16)17-2)8-9(12)5-7-13(11)15;3*1-2/h4-8,15H,3H2,1-2H3;1-2H3;2*1-2H2 |
| InChIKey | TZBJTDAPURKGIC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate?
The IUPAC name of ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate (CID 144537002) is ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate is C=C.C=C.CC.CCc1c(O)ccc2cc(C(=O)OC)ccc12.
What is the InChIKey of ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate?
The InChIKey is TZBJTDAPURKGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3.C2H6.2C2H4/c1-3-11-12-6-4-10(14(16)17-2)8-9(12)5-7-13(11)15;3*1-2/h4-8,15H,3H2,1-2H3;1-2H3;2*1-2H2.
What are the key properties of ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate?
ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate has a molecular weight of 316.44 g/mol, XLogP of 5.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;methyl 5-ethyl-6-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 144537002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).