C16H23NO2 — CID 143166835
ethane;methyl 3-ethyl-1,2-dimethylindole-6-carboxylate (PubChem CID 143166835) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is ethane;methyl 3-ethyl-1,2-dimethylindole-6-carboxylate.
| Compound Name | ethane;methyl 3-ethyl-1,2-dimethylindole-6-carboxylate |
|---|---|
| PubChem CID | 143166835 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethane;methyl 3-ethyl-1,2-dimethylindole-6-carboxylate |
| SMILES | CC.CCc1c(C)n(C)c2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C14H17NO2.C2H6/c1-5-11-9(2)15(3)13-8-10(14(16)17-4)6-7-12(11)13;1-2/h6-8H,5H2,1-4H3;1-2H3 |
| InChIKey | HLLQHSLXWWSJAN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|