C16H19BrNO4PS — CID 3806368
3-bromo-N-[4-(diethoxyphosphorylmethyl)phenyl]thiophene-2-carboxamide (PubChem CID 3806368) has the molecular formula C16H19BrNO4PS and a molecular weight of 432.28 g/mol. Its IUPAC name is 3-bromo-N-[4-(diethoxyphosphorylmethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[4-(diethoxyphosphorylmethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3806368 |
| Molecular Formula | C16H19BrNO4PS |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 3-bromo-N-[4-(diethoxyphosphorylmethyl)phenyl]thiophene-2-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)c2sccc2Br)cc1)OCC |
| InChI | InChI=1S/C16H19BrNO4PS/c1-3-21-23(20,22-4-2)11-12-5-7-13(8-6-12)18-16(19)15-14(17)9-10-24-15/h5-10H,3-4,11H2,1-2H3,(H,18,19) |
| InChIKey | IYQHQHNMAGOZTE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|