C21H42N4O12P2 — CID 87791716
10-[2,2-bis(diethoxyphosphoryl)ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 87791716) has the molecular formula C21H42N4O12P2 and a molecular weight of 604.53 g/mol. Its IUPAC name is 10-[2,2-bis(diethoxyphosphoryl)ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | 10-[2,2-bis(diethoxyphosphoryl)ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 87791716 |
| Molecular Formula | C21H42N4O12P2 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 10-[2,2-bis(diethoxyphosphoryl)ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | CCOP(=O)(OCC)C(CN1CCN(C(=O)O)CCN(C(=O)O)CCN(C(=O)O)CC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C21H42N4O12P2/c1-5-34-38(32,35-6-2)18(39(33,36-7-3)37-8-4)17-22-9-11-23(19(26)27)13-15-25(21(30)31)16-14-24(12-10-22)20(28)29/h18H,5-17H2,1-4H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | KPYAVVBPCVYAFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 195.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|