C10H20N2O2S2 — CID 87177968
4-[2-methyl-3-(methyldisulfanyl)propyl]piperazine-1-carboxylic acid (PubChem CID 87177968) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 4-[2-methyl-3-(methyldisulfanyl)propyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-methyl-3-(methyldisulfanyl)propyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87177968 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-[2-methyl-3-(methyldisulfanyl)propyl]piperazine-1-carboxylic acid |
| SMILES | CSSCC(C)CN1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C10H20N2O2S2/c1-9(8-16-15-2)7-11-3-5-12(6-4-11)10(13)14/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | DGXRNMHGBNGTOX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|