C11H25N3O10P2 — CID 18740682
4,7-bis(2-hydroxy-2-phosphonoethyl)-1,4,7-triazonane-1-carboxylic acid (PubChem CID 18740682) has the molecular formula C11H25N3O10P2 and a molecular weight of 421.28 g/mol. Its IUPAC name is 4,7-bis(2-hydroxy-2-phosphonoethyl)-1,4,7-triazonane-1-carboxylic acid.
| Compound Name | 4,7-bis(2-hydroxy-2-phosphonoethyl)-1,4,7-triazonane-1-carboxylic acid |
|---|---|
| PubChem CID | 18740682 |
| Molecular Formula | C11H25N3O10P2 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4,7-bis(2-hydroxy-2-phosphonoethyl)-1,4,7-triazonane-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(CC(O)P(=O)(O)O)CCN(CC(O)P(=O)(O)O)CC1 |
| InChI | InChI=1S/C11H25N3O10P2/c15-9(25(19,20)21)7-12-1-2-13(8-10(16)26(22,23)24)4-6-14(5-3-12)11(17)18/h9-10,15-16H,1-8H2,(H,17,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | JAEHTPBKMSZZQC-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 202.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|