About 2-(aziridin-1-yl)ethane-1,1-diol
2-(aziridin-1-yl)ethane-1,1-diol (PubChem CID 19973688) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is 2-(aziridin-1-yl)ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-(aziridin-1-yl)ethane-1,1-diol |
| PubChem CID | 19973688 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 2-(aziridin-1-yl)ethane-1,1-diol |
| SMILES | OC(O)CN1CC1 |
| InChI | InChI=1S/C4H9NO2/c6-4(7)3-5-1-2-5/h4,6-7H,1-3H2 |
| InChIKey | QCVLIFZWFMKPIE-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(aziridin-1-yl)ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aziridin-1-yl)ethane-1,1-diol?
The IUPAC name of 2-(aziridin-1-yl)ethane-1,1-diol (CID 19973688) is 2-(aziridin-1-yl)ethane-1,1-diol.
What is the SMILES notation for 2-(aziridin-1-yl)ethane-1,1-diol?
The canonical SMILES for 2-(aziridin-1-yl)ethane-1,1-diol is OC(O)CN1CC1.
What is the InChIKey of 2-(aziridin-1-yl)ethane-1,1-diol?
The InChIKey is QCVLIFZWFMKPIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c6-4(7)3-5-1-2-5/h4,6-7H,1-3H2.
What are the key properties of 2-(aziridin-1-yl)ethane-1,1-diol?
2-(aziridin-1-yl)ethane-1,1-diol has a molecular weight of 103.12 g/mol, XLogP of -1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aziridin-1-yl)ethane-1,1-diol is sourced from PubChem (CID 19973688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).