C4H9NO2 — CID 19973688
2-(aziridin-1-yl)ethane-1,1-diol (PubChem CID 19973688) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is 2-(aziridin-1-yl)ethane-1,1-diol.
| Compound Name | 2-(aziridin-1-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 19973688 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 2-(aziridin-1-yl)ethane-1,1-diol |
| SMILES | OC(O)CN1CC1 |
| InChI | InChI=1S/C4H9NO2/c6-4(7)3-5-1-2-5/h4,6-7H,1-3H2 |
| InChIKey | QCVLIFZWFMKPIE-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|