C13H25IN2OS — CID 153373819
4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide (PubChem CID 153373819) has the molecular formula C13H25IN2OS and a molecular weight of 384.33 g/mol. Its IUPAC name is 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide.
| Compound Name | 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide |
|---|---|
| PubChem CID | 153373819 |
| Molecular Formula | C13H25IN2OS |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide |
| SMILES | CSC(C)(C)CC(C)CN1CCN(C(=O)I)CC1 |
| InChI | InChI=1S/C13H25IN2OS/c1-11(9-13(2,3)18-4)10-15-5-7-16(8-6-15)12(14)17/h11H,5-10H2,1-4H3 |
| InChIKey | NCTNMKAYKFRODL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|