About 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide
4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide (PubChem CID 153373819) has the molecular formula C13H25IN2OS
and a molecular weight of 384.33 g/mol. Its IUPAC name is 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide.
Molecular Properties
| Compound Name | 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide |
| PubChem CID | 153373819 |
| Molecular Formula | C13H25IN2OS |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide |
| SMILES | CSC(C)(C)CC(C)CN1CCN(C(=O)I)CC1 |
| InChI | InChI=1S/C13H25IN2OS/c1-11(9-13(2,3)18-4)10-15-5-7-16(8-6-15)12(14)17/h11H,5-10H2,1-4H3 |
| InChIKey | NCTNMKAYKFRODL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide?
The IUPAC name of 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide (CID 153373819) is 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide.
What is the SMILES notation for 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide?
The canonical SMILES for 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide is CSC(C)(C)CC(C)CN1CCN(C(=O)I)CC1.
What is the InChIKey of 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide?
The InChIKey is NCTNMKAYKFRODL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25IN2OS/c1-11(9-13(2,3)18-4)10-15-5-7-16(8-6-15)12(14)17/h11H,5-10H2,1-4H3.
What are the key properties of 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide?
4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide has a molecular weight of 384.33 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethyl-4-methylsulfanylpentyl)piperazine-1-carbonyl iodide is sourced from PubChem (CID 153373819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).