C14H32N2O6P2 — CID 54169151
1-[2,2-bis(diethoxyphosphoryl)ethyl]piperazine (PubChem CID 54169151) has the molecular formula C14H32N2O6P2 and a molecular weight of 386.37 g/mol. Its IUPAC name is 1-[2,2-bis(diethoxyphosphoryl)ethyl]piperazine.
| Compound Name | 1-[2,2-bis(diethoxyphosphoryl)ethyl]piperazine |
|---|---|
| PubChem CID | 54169151 |
| Molecular Formula | C14H32N2O6P2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[2,2-bis(diethoxyphosphoryl)ethyl]piperazine |
| SMILES | CCOP(=O)(OCC)C(CN1CCNCC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H32N2O6P2/c1-5-19-23(17,20-6-2)14(13-16-11-9-15-10-12-16)24(18,21-7-3)22-8-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | OTUHCUWYCOFCPL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|